For research use only. Not for therapeutic Use.
LJI308(Cat No.:I013779)is an experimental small molecule being investigated for its potential as an immunomodulatory agent, particularly in the treatment of autoimmune diseases and cancer. It functions by targeting specific pathways involved in immune cell regulation, aiming to modulate the immune response in a controlled manner. By influencing immune cell signaling, LJI308 has the potential to reduce inflammation or enhance anti-tumor immunity. Currently in preclinical or early clinical development, the compound’s safety, efficacy, and long-term effects are being studied. Further research is necessary to determine its therapeutic potential and clinical applications.
CAS Number | 1627709-94-7 |
Molecular Formula | C₂₁H₁₈F₂N₂O₂ |
Purity | ≥95% |
Target | Ribosomal S6 Kinase (RSK) |
Solubility | DMSO: ≥ 32 mg/mL |
IUPAC Name | 2,6-difluoro-4-[4-(4-morpholin-4-ylphenyl)pyridin-3-yl]phenol |
InChI | InChI=1S/C21H18F2N2O2/c22-19-11-15(12-20(23)21(19)26)18-13-24-6-5-17(18)14-1-3-16(4-2-14)25-7-9-27-10-8-25/h1-6,11-13,26H,7-10H2 |
InChIKey | YUYJEQHNWKQNBT-UHFFFAOYSA-N |
SMILES | C1COCCN1C2=CC=C(C=C2)C3=C(C=NC=C3)C4=CC(=C(C(=C4)F)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |