For research use only. Not for therapeutic Use.
LL-BM 726 is a novel dipeptide antibiotic.
| Catalog Number | I030899 |
| CAS Number | 96695-56-6 |
| Synonyms | LL-BM 726; LL BM 726; LLBM 726; LL-BM-726; LLBM726; LL BM 726; |
| Molecular Formula | C13H21N5O5 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-2-((S)-2-amino-5-guanidinopentanamido)-2-((R)-1-hydroxy-2-oxocyclopent-3-en-1-yl)acetic acid |
| InChI | InChI=1S/C13H21N5O5/c14-7(3-2-6-17-12(15)16)10(20)18-9(11(21)22)13(23)5-1-4-8(13)19/h1,4,7,9,23H,2-3,5-6,14H2,(H,18,20)(H,21,22)(H4,15,16,17)/t7-,9+,13-/m0/s1 |
| InChIKey | DUYFQYOHZRZEAZ-HBSDOPKDSA-N |
| SMILES | O=C1C=CC[C@@]1(O)[C@H](NC([C@H](CCCNC(N)=N)N)=O)C(O)=O |
| Reference | 1: Ellestad GA, James JC, Morton GO, Siegel MM, McGahren WJ. LL-BM726: a novel dipeptide antibiotic. J Antibiot (Tokyo). 1985 Apr;38(4):541-3. PubMed PMID: 3839233. |
