For research use only. Not for therapeutic Use.
LLP6(CAT: I012508) is a potent and selective inhibitor of the protein kinase CK2 (Casein Kinase 2), widely used in cancer research and cell signaling studies. CK2 is an enzyme involved in various cellular processes, including cell growth, proliferation, and apoptosis, and is often overexpressed in several types of cancer. By inhibiting CK2, LLP6 helps to elucidate the role of this kinase in oncogenic signaling pathways and can contribute to the development of targeted cancer therapies. Researchers utilize LLP6 to study the molecular mechanisms underlying CK2-related functions and to explore its potential as a therapeutic target in cancer and other diseases where CK2 plays a pivotal role.
| Catalog Number | I012508 |
| CAS Number | 254902-10-8 |
| Synonyms | 6-(5-Chloro-2-hydroxy-phenyl)-2-oxo-4-phenyl-1,2-dihydro-pyridine-3-carbonitrile |
| Molecular Formula | C18H11ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 6-(5-chloro-2-hydroxyphenyl)-2-oxo-4-phenyl-1H-pyridine-3-carbonitrile |
| InChI | InChI=1S/C18H11ClN2O2/c19-12-6-7-17(22)14(8-12)16-9-13(11-4-2-1-3-5-11)15(10-20)18(23)21-16/h1-9,22H,(H,21,23) |
| InChIKey | YMRFUBCTDSEQIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=C2)C3=C(C=CC(=C3)Cl)O)C#N |
