For research use only. Not for therapeutic Use.
LLY-284 is the diastereomer of LLY-283, which is a potent and selective SAM-competitive chemical probe for PRMT5. LLY-284 is much less active than LLY-283 and can be used as a negative control for LLY-283.
| CAS Number | 2226515-75-7 |
| Molecular Formula | C17H18N4O4 |
| Purity | ≥95% |
| Storage | 3 years-20°Cpowder |
| SMILES | NC1=NC=NC2=C1C=C[N]2C3OC(C(O)C3O)C(O)C4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
