For research use only. Not for therapeutic Use.
LM22B-10 is an activator of TrkB/TrkC neurotrophin receptor, and can induce TrkB, TrkC, AKT and ERK activation in vitro and in vivo.
| Catalog Number | I013178 |
| CAS Number | 342777-54-2 |
| Molecular Formula | C₂₇H₃₃ClN₂O₄ |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO: ≥ 150 mg/mL |
| IUPAC Name | 2-[4-[[4-[bis(2-hydroxyethyl)amino]phenyl]-(4-chlorophenyl)methyl]-N-(2-hydroxyethyl)anilino]ethanol |
| InChI | InChI=1S/C27H33ClN2O4/c28-24-7-1-21(2-8-24)27(22-3-9-25(10-4-22)29(13-17-31)14-18-32)23-5-11-26(12-6-23)30(15-19-33)16-20-34/h1-12,27,31-34H,13-20H2 |
| InChIKey | QCXQLSGBOUUVNH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C2=CC=C(C=C2)N(CCO)CCO)C3=CC=C(C=C3)Cl)N(CCO)CCO |
| Reference | [1]. Yang T, et al. A small molecule TrkB/TrkC neurotrophin receptor co-activator with distinctive effects on neuronal survival and process outgrowth. Neuropharmacology. 2016 Nov;110(Pt A):343-61. |
