For research use only. Not for therapeutic Use.
LNP Lipid-7 (CAT: I040913) is a lipid compound used in the preparation of lipid nanoparticles (LNP), which are increasingly utilized for drug delivery applications. LNPs are essential for the encapsulation and transport of therapeutic agents, particularly RNA-based drugs like mRNA vaccines, due to their ability to protect the cargo from degradation and facilitate cellular uptake. LNP Lipid-7 can be incorporated into LNP formulations, improving their stability and enhancing drug delivery efficiency. This compound is highly relevant for pharmaceutical and material chemistry research, particularly in the development of advanced drug delivery systems, gene therapy, and vaccine delivery technologies.
CAS Number | 1190203-55-4 |
Synonyms | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanol |
Molecular Formula | C41H74O3 |
Purity | ≥95% |
IUPAC Name | 2-[2,2-bis[(9Z,12Z)-octadeca-9,12-dienyl]-1,3-dioxolan-4-yl]ethanol |
InChI | InChI=1S/C41H74O3/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-41(43-39-40(44-41)35-38-42)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11-14,17-20,40,42H,3-10,15-16,21-39H2,1-2H3/b13-11-,14-12-,19-17-,20-18- |
InChIKey | XGGMAKMFLSZTIY-MAZCIEHSSA-N |
SMILES | CCCCCC=CCC=CCCCCCCCCC1(OCC(O1)CCO)CCCCCCCCC=CCC=CCCCCC |