For research use only. Not for therapeutic Use.
LNP Lipid-8 (CAT: I040896) is an ionizable lipid designed for use in lipid nanoparticles (LNP) for efficient delivery of siRNA, particularly targeting T cells without the need for specific targeting ligands. This lipid formulation enables the successful encapsulation and delivery of siRNA, such as GFP siRNA (siGFP), to induce gene silencing. In mouse models, LNP Lipid-8 loaded with siGFP significantly causes GFP gene silencing, demonstrating its potential for RNA interference-based therapeutic strategies. This compound is particularly relevant for research in gene therapy, immunology, and RNA-based therapeutics, facilitating targeted gene silencing in immune cells like T cells.
CAS Number | 2408140-60-1 |
Synonyms | [2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[3-(diethylamino)propoxycarbonyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
Molecular Formula | C42H71NO7 |
Purity | ≥95% |
IUPAC Name | [2-[[2-(1-adamantyl)acetyl]oxymethyl]-3-[3-(diethylamino)propoxycarbonyloxy]propyl] (9Z,12Z)-octadeca-9,12-dienoate |
InChI | InChI=1S/C42H71NO7/c1-4-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22-39(44)48-32-38(34-50-41(46)47-24-21-23-43(5-2)6-3)33-49-40(45)31-42-28-35-25-36(29-42)27-37(26-35)30-42/h10-11,13-14,35-38H,4-9,12,15-34H2,1-3H3/b11-10-,14-13- |
InChIKey | FNGYOMDNOWZUBX-XVTLYKPTSA-N |
SMILES | CCCCCC=CCC=CCCCCCCCC(=O)OCC(COC(=O)CC12CC3CC(C1)CC(C3)C2)COC(=O)OCCCN(CC)CC |