For research use only. Not for therapeutic Use.
Lobeglitazone sulfate(Cat No.:I007681)is the sulfate salt form of lobeglitazone, a selective agonist of the peroxisome proliferator-activated receptor gamma (PPAR-γ). PPAR-γ plays a crucial role in regulating glucose and lipid metabolism, and its activation by lobeglitazone improves insulin sensitivity, making it useful in the management of type 2 diabetes mellitus. Lobeglitazone has demonstrated potential benefits in lowering blood glucose levels, improving lipid profiles, and reducing inflammation. It is typically studied as a treatment for metabolic disorders, with ongoing research focused on its long-term safety, efficacy, and potential benefits compared to other PPAR-γ agonists.
CAS Number | 763108-62-9 (Sulfate) |
Synonyms | CKD-501; CKD 501; CKD501; Lobeglitazone Sulfate. trade name Duvie, Chong Kun Dang.;5-(4-(2-((6-(4-methoxyphenoxy)pyrimidin-4-yl)(methyl)amino)ethoxy)benzyl)thiazolidine-2,4-dione sulfate |
Molecular Formula | C24H26N4O9S2 |
Purity | ≥95% |
Solubility | Soluble in DMSO |
Storage | 0 - 4°C for short term , or -20°C for long term. |
IUPAC Name | 5-[[4-[2-[[6-(4-methoxyphenoxy)pyrimidin-4-yl]-methylamino]ethoxy]phenyl]methyl]-1,3-thiazolidine-2,4-dione;sulfuric acid |
InChI | InChI=1S/C24H24N4O5S.H2O4S/c1-28(21-14-22(26-15-25-21)33-19-9-7-17(31-2)8-10-19)11-12-32-18-5-3-16(4-6-18)13-20-23(29)27-24(30)34-20;1-5(2,3)4/h3-10,14-15,20H,11-13H2,1-2H3,(H,27,29,30);(H2,1,2,3,4) |
InChIKey | IFBYQAMJTBOBHB-UHFFFAOYSA-N |
SMILES | CN(CCOC1=CC=C(C=C1)CC2C(=O)NC(=O)S2)C3=CC(=NC=N3)OC4=CC=C(C=C4)OC.OS(=O)(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |