For research use only. Not for therapeutic Use.
Lodoxamide Tromethamine(CAT: I013656) is a potent mast cell stabilizer that inhibits the release of histamine and other inflammatory mediators from sensitized mast cells. By preventing mast cell degranulation, it effectively reduces allergic responses, making it valuable in immunology and inflammation research. Lodoxamide is primarily studied for its role in managing allergic conjunctivitis, asthma, and other hypersensitivity disorders. Its mechanism involves blocking calcium influx into mast cells, thereby suppressing the release of pro-inflammatory substances. Researchers utilize Lodoxamide Tromethamine to explore allergic reaction pathways and develop targeted therapies for allergic and inflammatory conditions.
CAS Number | 63610-09-3 |
Molecular Formula | C₁₉H₂₈ClN₅O₁₂ |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | DMSO: 20 mg/mL |
IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;2-[2-chloro-5-cyano-3-(oxaloamino)anilino]-2-oxoacetic acid |
InChI | InChI=1S/C11H6ClN3O6.2C4H11NO3/c12-7-5(14-8(16)10(18)19)1-4(3-13)2-6(7)15-9(17)11(20)21;2*5-4(1-6,2-7)3-8/h1-2H,(H,14,16)(H,15,17)(H,18,19)(H,20,21);2*6-8H,1-3,5H2 |
InChIKey | JJOFNSLZHKIJEV-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1NC(=O)C(=O)O)Cl)NC(=O)C(=O)O)C#N.C(C(CO)(CO)N)O.C(C(CO)(CO)N)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |