For research use only. Not for therapeutic Use.
Lomefloxacin Hydrochloride(Cat No.:A000853)is a fluoroquinolone antibiotic effective against a range of Gram-negative and some Gram-positive bacteria. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, enzymes essential for DNA replication and repair, leading to bacterial cell death. Lomefloxacin is commonly used to treat urinary tract infections and respiratory infections like bronchitis. Known for its high oral bioavailability and extended half-life, it allows for convenient once-daily dosing. Lomefloxacin’s broad-spectrum activity and favorable pharmacokinetics make it a valuable choice in outpatient bacterial infection management.
Catalog Number | A000853 |
CAS Number | 98079-52-8 |
Synonyms | Lomefloxacin hydrochloride; 98079-52-8; Maxaquin; Lomefloxacin HCl; Bareon; Okacyn |
Molecular Formula | C17H20ClF2N3O3 |
Purity | ≥95% |
Target | Bacterial |
Storage | -20°C |
IUPAC Name | 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid;hydrochloride |
InChI | InChI=1S/C17H19F2N3O3.ClH/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22;/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25);1H |
InChIKey | KXEBLAPZMOQCKO-UHFFFAOYSA-N |
SMILES | CCN1C=C(C(=O)C2=CC(=C(C(=C21)F)N3CCNC(C3)C)F)C(=O)O.Cl |
Reference | 1: Abdelbary A, Salem HF, Khallaf RA, Ali AM. Mucoadhesive niosomal in situ gel <br> 3: Yasueda S, Higashiyama M, Yamaguchi M, Isowaki A, Ohtori A. Corneal critical 4: Sultana N, Arayne MS, Furqan H. In vitro availability of lomefloxacin 5: Bai ZZ, Zhang QS, Sheng LS. [Study on photodegradation kinetics of <br> 7: Derevianko II, Lopatkin NA, Khodyreva LA, Kondrat/’eva EM. [The use of Maxaquin 8: Kuznetsovoĭ SM. [Lomefloxacin hydrochloride (Maxaquin), a long-acting |