For research use only. Not for therapeutic Use.
Lomefloxacin（Cat No.:I005723）is a broad-spectrum fluoroquinolone antibiotic used to treat bacterial infections, particularly respiratory and urinary tract infections. It works by inhibiting bacterial DNA gyrase and topoisomerase IV, essential enzymes for DNA replication and transcription, leading to bacterial cell death. Lomefloxacin is known for its high oral bioavailability and once-daily dosing, which improves patient compliance. Effective against various gram-negative and some gram-positive bacteria, it is commonly used in outpatient settings. Due to its photosensitivity risk, patients are advised to avoid excessive sunlight during treatment.
| Catalog Number | I005723 |
| CAS Number | 98079-51-7 |
| Synonyms | SC47111A |
| Molecular Formula | C17H19F2N3O3 |
| Purity | ≥95% |
| Solubility | 10mM in water (partly soluble) |
| Storage | 3 years -20C powder |
| IUPAC Name | 1-ethyl-6,8-difluoro-7-(3-methylpiperazin-1-yl)-4-oxoquinoline-3-carboxylic acid |
| InChI | InChI=1S/C17H19F2N3O3/c1-3-21-8-11(17(24)25)16(23)10-6-12(18)15(13(19)14(10)21)22-5-4-20-9(2)7-22/h6,8-9,20H,3-5,7H2,1-2H3,(H,24,25) |
| InChIKey | ZEKZLJVOYLTDKK-UHFFFAOYSA-N |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C(=C21)F)N3CCNC(C3)C)F)C(=O)O |
| Reference | [1]. http://www.drugbank.ca/drugs/DB00978 |
