For research use only. Not for therapeutic Use.
Lomustine（Cat No.:A001123）is an alkylating chemotherapy agent used primarily for treating brain tumors, including gliomas and Hodgkin’s lymphoma. It works by causing DNA cross-linking, which disrupts DNA replication and leads to cell death, particularly in rapidly dividing cancer cells. Lomustine’s ability to cross the blood-brain barrier makes it particularly effective in treating central nervous system malignancies. It is typically used in combination with other chemotherapy agents to enhance therapeutic outcomes. Lomustine is widely studied in cancer research for its role in overcoming resistance and improving patient survival rates.
| CAS Number | 13010-47-4 |
| Synonyms | c79037 |
| Molecular Formula | C9H16ClN3O2 |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | >11.7mg/mL in DMSO |
| Storage | -20 ℃ |
| IUPAC Name | 1-(2-chloroethyl)-3-cyclohexyl-1-nitrosourea |
| InChI | InChI=1S/C9H16ClN3O2/c10-6-7-13(12-15)9(14)11-8-4-2-1-3-5-8/h8H,1-7H2,(H,11,14) |
| InChIKey | GQYIWUVLTXOXAJ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC(=O)N(CCCl)N=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
