For research use only. Not for therapeutic Use.
Longdaysin(Cat No.:I019141)is a small molecule inhibitor that targets casein kinase 1 (CK1) and cyclin-dependent kinases (CDKs), particularly CDK7 and CDK9, which are key regulators of the circadian clock. By inhibiting these kinases, Longdaysin lengthens the circadian period, disrupting normal cellular rhythms. It has been used in research to study the molecular mechanisms of circadian regulation and its impact on physiological processes. Additionally, Longdaysin’s ability to modulate kinase activity has potential applications in cancer research, where circadian disruptions and kinase dysregulation play critical roles in tumor progression.
CAS Number | 1353867-91-0 |
Molecular Formula | C₁₆H₁₆F₃N₅ |
Purity | ≥95% |
Target | Stem Cell/Wnt |
IUPAC Name | 9-propan-2-yl-N-[[3-(trifluoromethyl)phenyl]methyl]purin-6-amine |
InChI | InChI=1S/C16H16F3N5/c1-10(2)24-9-23-13-14(21-8-22-15(13)24)20-7-11-4-3-5-12(6-11)16(17,18)19/h3-6,8-10H,7H2,1-2H3,(H,20,21,22) |
InChIKey | REKSFCCYDQMSIN-UHFFFAOYSA-N |
SMILES | CC(C)N1C=NC2=C(N=CN=C21)NCC3=CC(=CC=C3)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |