For research use only. Not for therapeutic Use.
Longiborneol(Cat No.:I030974)is a naturally occurring sesquiterpenoid alcohol, typically isolated from certain plant species, including those in the genus Longifolium. It is known for its unique chemical structure and potential bioactive properties, including anti-inflammatory and antioxidant effects. Longiborneol has been studied for its potential therapeutic applications in areas such as pain management, wound healing, and inflammation-related conditions. Due to its relatively low toxicity and natural origin, it is of interest in the development of safer, plant-based therapeutic agents. Research is ongoing to explore its full pharmacological profile and potential medicinal uses.
CAS Number | 465-24-7 |
Synonyms | Longiborneol |
Molecular Formula | C15H26O |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | (8S)-2,6,6,9-tetramethyltricyclo[5.4.0.02,9]undecan-8-ol |
InChI | InChI=1S/C15H26O/c1-13(2)7-5-8-14(3)10-6-9-15(14,4)12(16)11(10)13/h10-12,16H,5-9H2,1-4H3/t10?,11?,12-,14?,15?/m0/s1 |
InChIKey | MNNFKQAYXGEKFA-MJBFILCRSA-N |
SMILES | CC1(CCCC2(C3C1[C@@H](C2(CC3)C)O)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |