For research use only. Not for therapeutic Use.
Lonidamine（Cat No.:A000299）is a glycolysis inhibitor that disrupts energy metabolism in cancer cells by targeting mitochondria and inhibiting hexokinase II. By impairing glycolysis and oxidative phosphorylation, lonidamine reduces ATP production, selectively affecting cancer cells that heavily rely on glycolytic pathways. It is particularly effective in hypoxic tumor environments, where traditional treatments are less effective. Lonidamine’s unique mechanism has led to its exploration as an adjuvant in cancer therapy, enhancing the efficacy of chemotherapy and radiation. Its metabolic targeting provides a promising approach in research on energy-dependent cancers.
| Catalog Number | A000299 |
| CAS Number | 50264-69-2 |
| Synonyms | AF 1890, Diclondazolic Acid |
| Molecular Formula | C₁₅H₁₀Cl₂N₂O₂ |
| Purity | ≥95% |
| Target | hexokinase |
| Storage | 3 years -20C powder |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]indazole-3-carboxylic acid |
| InChI | InChI=1S/C15H10Cl2N2O2/c16-10-6-5-9(12(17)7-10)8-19-13-4-2-1-3-11(13)14(18-19)15(20)21/h1-7H,8H2,(H,20,21) |
| InChIKey | WDRYRZXSPDWGEB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NN2CC3=C(C=C(C=C3)Cl)Cl)C(=O)O |
