For research use only. Not for therapeutic Use.
Lophophorine HCl is discontinued (DEA controlled substance). Lophophorine HCl is a peyote alkaloid.
| Catalog Number | I030985 |
| CAS Number | 6112-95-4 |
| Synonyms | Lophophorine hydrochloride; Lophophorine HCl; Lophophorine, hydrochloride, (-)-; |
| Molecular Formula | C13H18ClNO3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | (S)-4-methoxy-8,9-dimethyl-6,7,8,9-tetrahydro-[1,3]dioxolo[4,5-h]isoquinoline hydrochloride |
| InChI | InChI=1S/C13H17NO3.ClH/c1-8-11-9(4-5-14(8)2)6-10(15-3)12-13(11)17-7-16-12;/h6,8H,4-5,7H2,1-3H3;1H/t8-;/m0./s1 |
| InChIKey | KCIKWLFLJHFKRA-QRPNPIFTSA-N |
| SMILES | C[C@@H]1N(C)CCC2=C1C(OCO3)=C3C(OC)=C2.[H]Cl |
| Reference | 1: Bruhn JG, Lindgren JE, Holmstedt B, Adovasio JM. Peyote alkaloids: identification in a prehistoric specimen of lophophora from coahuila, Mexico. Science. 1978 Mar 31;199(4336):1437-8. PubMed PMID: 17796678. |
