For research use only. Not for therapeutic Use.
Loroglossin（Cat No.:R066430）, is a naturally occurring compound found in certain plant species, particularly those in the Loranthaceae family. It is known for its interesting chemical structure and potential bioactivity. Loroglossin has attracted attention in scientific research due to its structural complexity and the possibility of it playing a role in plant defense mechanisms or ecological interactions.
| Catalog Number | R066430 |
| CAS Number | 58139-22-3 |
| Molecular Formula | C34H46O18 |
| Purity | ≥95% |
| Target | Plants |
| Storage | -20°C |
| IUPAC Name | bis[[4-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]methyl] (2R,3S)-2,3-dihydroxy-2-(2-methylpropyl)butanedioate |
| InChI | InChI=1S/C34H46O18/c1-16(2)11-34(46,33(45)48-15-18-5-9-20(10-6-18)50-32-28(42)26(40)24(38)22(13-36)52-32)29(43)30(44)47-14-17-3-7-19(8-4-17)49-31-27(41)25(39)23(37)21(12-35)51-31/h3-10,16,21-29,31-32,35-43,46H,11-15H2,1-2H3/t21-,22-,23-,24-,25+,26+,27-,28-,29-,31-,32-,34-/m1/s1 |
| InChIKey | QABASLXUKXNHMC-PIFIRMJRSA-N |
| SMILES | CC(C)CC(C(C(=O)OCC1=CC=C(C=C1)OC2C(C(C(C(O2)CO)O)O)O)O)(C(=O)OCC3=CC=C(C=C3)OC4C(C(C(C(O4)CO)O)O)O)O |
