For research use only. Not for therapeutic Use.
Loteprednol Etabonate(CAT: A001102) is a corticosteroid used primarily for treating ocular inflammation and allergic eye conditions, such as conjunctivitis and postoperative inflammation. Its mechanism involves inhibiting the production of pro-inflammatory mediators, thereby reducing redness, swelling, and discomfort in the eyes. Unlike traditional corticosteroids, Loteprednol Etabonate is an ester-based compound designed to minimize side effects, as it is quickly metabolized into inactive forms. This unique property enhances its safety profile, making it a preferred choice for long-term management of eye inflammation.
CAS Number | 82034-46-6 |
Synonyms | NA |
Molecular Formula | C24H31ClO7 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
Solubility | >17mg/mL in DMSO |
Storage | 3 years -20 ℃ |
IUPAC Name | chloromethyl (8S,9S,10R,11S,13S,14S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
InChI | 1S/C24H31ClO7/c1-4-30-21(29)32-24(20(28)31-13-25)10-8-17-16-6-5-14-11-15(26)7-9-22(14,2)19(16)18(27)12-23(17,24)3/h7,9,11,16-19,27H,4-6,8,10,12-13H2,1-3H3/t16-,17-,18-,19+,22-,23-,24-/m0/s1 |
InChIKey | DMKSVUSAATWOCU-HROMYWEYSA-N |
SMILES | CCOC(=O)O[C@@]1(CC[C@@H]2[C@@]1(C[C@@H]([C@H]3[C@H]2CCC4=CC(=O)C=C[C@]34C)O)C)C(=O)OCCl |