Loteprednol Etabonate-d5(Cat No.:S000841) is a deuterated form of loteprednol etabonate, where five hydrogen atoms are replaced with deuterium, giving it the molecular formula C24H26D5ClO7. This stable isotope-labeled compound is extensively used in analytical chemistry, particularly in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, to improve the detection and measurement of drug metabolism and disposition. Loteprednol Etabonate-d5 is crucial in ophthalmological research, aiding in the study of its pharmacokinetics and therapeutic efficacy in treating inflammatory eye conditions such as postoperative inflammation and chronic conditions like uveitis and allergic conjunctivitis.
Catalog Number | S000841 |
CAS Number | 2026643-11-6 |
Molecular Formula | C24H26D5ClO7 |
Purity | ≥95% |
IUPAC Name | chloromethyl (8S,9S,10R,11S,13S,14S,17R)-11-hydroxy-10,13-dimethyl-3-oxo-17-(1,1,2,2,2-pentadeuterioethoxycarbonyloxy)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-17-carboxylate |
InChI | InChI=1S/C24H31ClO7/c1-4-30-21(29)32-24(20(28)31-13-25)10-8-17-16-6-5-14-11-15(26)7-9-22(14,2)19(16)18(27)12-23(17,24)3/h7,9,11,16-19,27H,4-6,8,10,12-13H2,1-3H3/t16-,17-,18-,19+,22-,23-,24-/m0/s1/i1D3,4D2 |
InChIKey | DMKSVUSAATWOCU-JZCUTVDWSA-N |
SMILES | CCOC(=O)OC1(CCC2C1(CC(C3C2CCC4=CC(=O)C=CC34C)O)C)C(=O)OCCl |