For research use only. Not for therapeutic Use.
Loureirin A(Cat No.:I013096)is a flavonoid compound derived from the roots of Paeonia suffruticosa, a plant used in traditional medicine. It has been studied for its various biological activities, including antioxidant, anti-inflammatory, and anticancer properties. Loureirin A demonstrates the ability to scavenge free radicals, reduce inflammation, and inhibit tumor cell proliferation, making it a potential candidate for cancer therapy. Additionally, research suggests it may protect against neurodegenerative diseases by promoting cell survival and reducing oxidative damage. Ongoing studies are exploring its therapeutic applications and safety profile for treating various diseases.
CAS Number | 119425-89-7 |
Molecular Formula | C₁₇H₁₈O₄ |
Purity | ≥95% |
Target | Akt |
Solubility | DMSO |
IUPAC Name | 3-(2,4-dimethoxyphenyl)-1-(4-hydroxyphenyl)propan-1-one |
InChI | InChI=1S/C17H18O4/c1-20-15-9-5-13(17(11-15)21-2)6-10-16(19)12-3-7-14(18)8-4-12/h3-5,7-9,11,18H,6,10H2,1-2H3 |
InChIKey | RSAIVLRELNGZEY-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(C=C1)CCC(=O)C2=CC=C(C=C2)O)OC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |