For research use only. Not for therapeutic Use.
Loviride is an antiviral drug primarily used in the treatment of HIV infection. It belongs to the class of non-nucleoside reverse transcriptase inhibitors (NNRTIs), working by inhibiting the reverse transcriptase enzyme, which is crucial for the replication of HIV. By blocking this enzyme, Loviride helps reduce the viral load in the body. While effective, it is typically used in combination with other antiretroviral drugs for a more comprehensive approach to HIV treatment. Loviride’s side effect profile and resistance potential limit its widespread use.
| Catalog Number | M093940 |
| CAS Number | 147362-57-0 |
| Synonyms | Loviride |
| Molecular Formula | C17H16Cl2N2O2 |
| Purity | ≥95% |
| Target | DNA polymerase inhibitor |
| Storage | Desiccate at +4C |
| IUPAC Name | 2-(2-acetyl-5-methylanilino)-2-(2,6-dichlorophenyl)acetamide |
| InChI | InChI=1S/C17H16Cl2N2O2/c1-9-6-7-11(10(2)22)14(8-9)21-16(17(20)23)15-12(18)4-3-5-13(15)19/h3-8,16,21H,1-2H3,(H2,20,23) |
| InChIKey | CJPLEFFCVDQQFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)C)NC(C2=C(C=CC=C2Cl)Cl)C(=O)N |
