For research use only. Not for therapeutic Use.
Loxoprofen(Cat No.:I004583) is a non-steroidal anti-inflammatory drug (NSAID) that is commonly used to relieve pain and reduce inflammation. It belongs to the propionic acid derivative class of NSAIDs. Loxoprofen works by inhibiting the production of prostaglandins, which are substances that contribute to pain and inflammation. Due to its anti-inflammatory and analgesic properties, loxoprofen is often prescribed for conditions such as arthritis, muscle strains, and postoperative pain.
CAS Number | 68767-14-6 |
Synonyms | 2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
Molecular Formula | C15H18O3 |
Purity | ≥95% |
Target | COX |
Solubility | water:0.81 mg/ml |
Storage | Room Temperature |
IUPAC Name | 2-[4-[(2-oxocyclopentyl)methyl]phenyl]propanoic acid |
InChI | InChI=1S/C15H18O3/c1-10(15(17)18)12-7-5-11(6-8-12)9-13-3-2-4-14(13)16/h5-8,10,13H,2-4,9H2,1H3,(H,17,18) |
InChIKey | YMBXTVYHTMGZDW-UHFFFAOYSA-N |
SMILES | CC(C1=CC=C(C=C1)CC2CCCC2=O)C(=O)O |
Reference | <p style=/line-height:25px/> </p> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |