For research use only. Not for therapeutic Use.
LP44 hydrochloride（Cat No.:R026150）is a small molecule compound that acts as a selective inhibitor targeting specific enzymes or signaling pathways involved in cellular processes such as cell growth, apoptosis, and immune regulation. It has shown potential in preclinical studies for its ability to modulate the immune response and inhibit the proliferation of cancer cells. LP44 hydrochloride may be useful in cancer research and other disease models, offering valuable insights into therapeutic strategies for tumors or immune-related disorders. Its high specificity and potency make it a promising candidate for the development of targeted therapies in oncology and immunology.
| CAS Number | 824958-12-5 |
| Synonyms | 6-[4-(2-methylsulfanylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide;hydrochloride |
| Molecular Formula | C27H38ClN3OS |
| Purity | ≥95% |
| IUPAC Name | 6-[4-(2-methylsulfanylphenyl)piperazin-1-yl]-N-(1,2,3,4-tetrahydronaphthalen-1-yl)hexanamide;hydrochloride |
| InChI | InChI=1S/C27H37N3OS.ClH/c1-32-26-15-7-6-14-25(26)30-20-18-29(19-21-30)17-8-2-3-16-27(31)28-24-13-9-11-22-10-4-5-12-23(22)24;/h4-7,10,12,14-15,24H,2-3,8-9,11,13,16-21H2,1H3,(H,28,31);1H |
| InChIKey | DWGKCWWWKHCVDH-UHFFFAOYSA-N |
| SMILES | CSC1=CC=CC=C1N2CCN(CC2)CCCCCC(=O)NC3CCCC4=CC=CC=C34.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
