For research use only. Not for therapeutic Use.
LQZ-7I(Cat No.:I015175) is a specific inhibitor that targets survivin, a protein involved in promoting cell survival and inhibiting apoptosis. LQZ-7I functions by inhibiting survivin dimerization, a crucial step for its anti-apoptotic activity. In preclinical studies, LQZ-7I has demonstrated effective oral administration in inhibiting the growth of xenograft tumors, suggesting its potential as an anticancer agent. Additionally, LQZ-7I induces the loss of survivin within tumors, further highlighting its ability to disrupt survivin-mediated pathways.
CAS Number | 195822-23-2 |
Molecular Formula | C₂₀H₁₄F₂N₄ |
Purity | ≥95% |
Target | Survivin |
Storage | Room temperature |
IUPAC Name | 2-N,3-N-bis(4-fluorophenyl)quinoxaline-2,3-diamine |
InChI | InChI=1S/C20H14F2N4/c21-13-5-9-15(10-6-13)23-19-20(24-16-11-7-14(22)8-12-16)26-18-4-2-1-3-17(18)25-19/h1-12H,(H,23,25)(H,24,26) |
InChIKey | DKPCKOKYSVPFEB-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)N=C(C(=N2)NC3=CC=C(C=C3)F)NC4=CC=C(C=C4)F |
Reference | [1]. Robert Peery,et al. Synthesis and Identification of a Novel Lead Targeting Survivin Dimerization for Proteasome-Dependent Degradation. J Med Chem. 2020 Jun 9. |