For research use only. Not for therapeutic Use.
LUF6096(CAT: I012501) is a selective agonist known for its activity at the adenosine A2B receptor, making it a valuable tool in cardiovascular and immunological research. This compound has been studied for its potential to modulate immune responses, inflammation, and vascular function by activating the A2B receptor, which plays a critical role in various physiological processes. LUF6096 is particularly useful in exploring the therapeutic potential of targeting the adenosine A2B receptor for treating conditions such as asthma, inflammatory diseases, and cardiovascular disorders. Researchers in pharmacology and drug discovery use LUF6096 to investigate receptor-ligand interactions, receptor signaling pathways, and the development of novel therapies aimed at modulating the adenosine system.
CAS Number | 1116652-18-6 |
Synonyms | N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide |
Molecular Formula | C22H21Cl2N3O |
Purity | ≥95% |
IUPAC Name | N-[2-(3,4-dichloroanilino)quinolin-4-yl]cyclohexanecarboxamide |
InChI | InChI=1S/C22H21Cl2N3O/c23-17-11-10-15(12-18(17)24)25-21-13-20(16-8-4-5-9-19(16)26-21)27-22(28)14-6-2-1-3-7-14/h4-5,8-14H,1-3,6-7H2,(H2,25,26,27,28) |
InChIKey | UWEIQVQNNLVOEI-UHFFFAOYSA-N |
SMILES | C1CCC(CC1)C(=O)NC2=CC(=NC3=CC=CC=C32)NC4=CC(=C(C=C4)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |