For research use only. Not for therapeutic Use.
LUF6283（Cat No.:I011047）is a potent, selective inhibitor targeting the protein kinase activity of the Janus kinase (JAK) family, specifically JAK3. JAK3 is involved in immune system signaling and is crucial for the development of certain autoimmune disorders and hematological cancers. By inhibiting JAK3, LUF6283 may modulate immune responses and suppress inflammatory pathways, offering therapeutic potential for conditions such as rheumatoid arthritis, psoriasis, and certain blood cancers. Ongoing research is exploring the safety and efficacy of LUF6283 as a treatment option for autoimmune diseases and cancer therapies.
| CAS Number | 92933-48-7 |
| Synonyms | 5-butyl-1H-pyrazole-3-carboxylic acid |
| Molecular Formula | C8H12N2O2 |
| Purity | ≥95% |
| IUPAC Name | 5-butyl-1H-pyrazole-3-carboxylic acid |
| InChI | InChI=1S/C8H12N2O2/c1-2-3-4-6-5-7(8(11)12)10-9-6/h5H,2-4H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | ZJTXSGLJNBAMJS-UHFFFAOYSA-N |
| SMILES | CCCCC1=CC(=NN1)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
