For research use only. Not for therapeutic Use.
Luliconazole(Cat No.:A000163)is a potent topical antifungal agent used to treat dermatophytic infections such as athlete’s foot, jock itch, and ringworm. It belongs to the imidazole class and works by inhibiting ergosterol synthesis, a critical component of fungal cell membranes, leading to cell membrane disruption and fungal death. Known for its broad-spectrum activity, Luliconazole effectively targets dermatophytes, yeasts, and molds with minimal systemic absorption. Its high potency allows for shorter treatment durations compared to other antifungals, making it a preferred option in dermatological therapies. It is commonly available as creams or solutions.
Catalog Number | A000163 |
CAS Number | 187164-19-8 |
Synonyms | 187164-19-8; Lulicon; Luzu; NND-502; PR-2699 |
Molecular Formula | C14H9Cl2N3S2 |
Purity | ≥95% |
Target | Fungal |
Solubility | >17.7mg/mL in DMSO |
Storage | Store at -20°C |
IUPAC Name | (2E)-2-[(4R)-4-(2,4-dichlorophenyl)-1,3-dithiolan-2-ylidene]-2-imidazol-1-ylacetonitrile |
InChI | InChI=1S/C14H9Cl2N3S2/c15-9-1-2-10(11(16)5-9)13-7-20-14(21-13)12(6-17)19-4-3-18-8-19/h1-5,8,13H,7H2/b14-12+/t13-/m0/s1 |
InChIKey | YTAOBBFIOAEMLL-REQDGWNSSA-N |
SMILES | C1[C@H](S/C(=C(\C#N)/N2C=CN=C2)/S1)C3=C(C=C(C=C3)Cl)Cl |
Reference | 1: Shokoohi GR, Badali H, Mirhendi H, Ansari S, Rezaei-Matehkolaei A, Ahmadi B, 2: Zargaran M, Taghipour S, Kiasat N, Aboualigalehdari E, Rezaei-Matehkolaei A, 3: Watanabe S, Kishida H, Okubo A. Efficacy and safety of luliconazole 5% nail 4: Zhou BR, Lu Y, Permatasari F, Huang H, Li J, Liu J, Zhang JA, Luo D, Xu Y. The 5: Abastabar M, Rahimi N, Meis JF, Aslani N, Khodavaisy S, Nabili M, 6: Sarkar S, Sengupta D, Basak S, Damji SA, Shukla DK, Anurag D. Comparative 7: Saunders J, Maki K, Koski R, Nybo SE. Tavaborole, Efinaconazole, and 8: Baghi N, Shokohi T, Badali H, Makimura K, Rezaei-Matehkolaei A, Abdollahi M, 9: Hasuko M, Toga T, Tsunemitsu T, Matsumoto T, Koga H, Hirano H, Tsuboi R. 10: Shimamura T, Miyamae A, Arai M, Minemura A, Nozawa A, Kubota N. [Distribution |