For research use only. Not for therapeutic Use.
Lumichrome-d8(Cat No.:R063119) is a deuterated version of lumichrome, where eight hydrogen atoms are replaced with deuterium. This isotopic enhancement increases the molecule’s stability and makes it highly valuable for spectroscopic analysis, particularly in nuclear magnetic resonance (NMR) studies. Lumichrome is a photodegradation product of riboflavin (vitamin B2) and plays a role in biological systems, influencing cellular metabolism and redox processes.
CAS Number | NA |
Synonyms | 7,8-Dimethylbenzo[g]pteridine-2,4(1H,3H)-dione-d8;7,8-Dimethylalloxazine-d8; 7,8-Dimethylisoalloxazine-d8; NSC 96911-d8; Riboflavin lumichrome-d8 |
Molecular Formula | C₁₂H₂D₈N₄O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 6,9-dideuterio-7,8-bis(trideuteriomethyl)-1H-benzo[g]pteridine-2,4-dione |
InChI | InChI=1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18)/i1D3,2D3,3D,4D |
InChIKey | ZJTJUVIJVLLGSP-PIODKIDGSA-N |
SMILES | CC1=CC2=C(C=C1C)N=C3C(=N2)C(=O)NC(=O)N3 |