For research use only. Not for therapeutic Use.
Lumichrome(Cat No.: R041590) is a photoproduct of the vitamin B2 (riboflavin) that forms under ultraviolet (UV) light exposure. It is a type of flavin compound with antioxidant properties and is involved in various biological processes, including the regulation of plant growth and response to light. In plants, lumichrome plays a role in photomorphogenesis, influencing development and stress response. It has also shown potential in antimicrobial research due to its ability to modulate light-induced biological activity. Further studies are needed to explore its broader therapeutic applications.
| Catalog Number | R041590 |
| CAS Number | 1086-80-2 |
| Synonyms | 7,8-Dimethylbenzo[g]pteridine-2,4(1H,3H)-dione;7,8-Dimethylalloxazine; 7,8-Dimethylisoalloxazine; NSC 96911; Riboflavin lumichrome |
| Molecular Formula | C12H10N4O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | 7,8-dimethyl-1H-benzo[g]pteridine-2,4-dione |
| InChI | InChI=1S/C12H10N4O2/c1-5-3-7-8(4-6(5)2)14-10-9(13-7)11(17)16-12(18)15-10/h3-4H,1-2H3,(H2,14,15,16,17,18) |
| InChIKey | ZJTJUVIJVLLGSP-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)N=C3C(=N2)C(=O)NC(=O)N3 |
