For research use only. Not for therapeutic Use.
Lumiflavin-3-acetic acid is a derivative of lumiflavin, a naturally occurring flavin compound involved in biological redox processes. Lumiflavin-3-acetic acid features an acetic acid group attached to the lumiflavin molecule, enhancing its solubility and stability in aqueous environments. This compound is used in biochemical research as a fluorescent probe and cofactor analog. Its structural modifications enable unique applications in studying flavoprotein activity and enzyme kinetics. Lumiflavin-3-acetic acid contributes to advancements in understanding cellular metabolism and redox regulation.
Catalog Number | R055727 |
CAS Number | 20227-26-3 |
Synonyms | 4,10-Dihydro-7,8,10-trimethyl-2,4-dioxobenzo[g]pteridine-3(2H)-acetic Acid; 3-(Carboxymethyl)lumiflavin; Flavin I; N3-Carboxymethyl Lumiflavin; |
Molecular Formula | C15H14N4O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-(7,8,10-trimethyl-2,4-dioxobenzo[g]pteridin-3-yl)acetic acid |
InChI | InChI=1S/C15H14N4O4/c1-7-4-9-10(5-8(7)2)18(3)13-12(16-9)14(22)19(6-11(20)21)15(23)17-13/h4-5H,6H2,1-3H3,(H,20,21) |
InChIKey | GJSCQGXLPDWOMG-UHFFFAOYSA-N |
SMILES | CC1=CC2=C(C=C1C)N(C3=NC(=O)N(C(=O)C3=N2)CC(=O)O)C |