For research use only. Not for therapeutic Use.
Lumogallion（Cat No.:I031128）is a fluorescent compound commonly used in chemical and biological research to detect and quantify metal ions, particularly aluminum. It binds specifically to aluminum ions, forming a highly fluorescent complex that can be easily detected using fluorescence spectroscopy. This makes Lumogallion valuable in studying aluminum accumulation in biological systems, such as in neurodegenerative diseases like Alzheimer’s, where aluminum toxicity is suspected to play a role. Additionally, Lumogallion is used in environmental monitoring and other analytical applications to measure metal ion concentrations with high sensitivity and selectivity.
| CAS Number | 4386-25-8 |
| Synonyms | 5-chloro-3-[(2,4-dihydroxyphenyl)diazenyl]-2-hydroxybenzenesulfonic acid |
| Molecular Formula | C12H9ClN2O6S |
| Purity | ≥95% |
| IUPAC Name | 5-chloro-3-[(2,4-dihydroxyphenyl)diazenyl]-2-hydroxybenzenesulfonic acid |
| InChI | InChI=1S/C12H9ClN2O6S/c13-6-3-9(12(18)11(4-6)22(19,20)21)15-14-8-2-1-7(16)5-10(8)17/h1-5,16-18H,(H,19,20,21) |
| InChIKey | OTKYOGBGHUUFPC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)O)N=NC2=C(C(=CC(=C2)Cl)S(=O)(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
