For research use only. Not for therapeutic Use.
Lunacrine (Cat No.: I031143) is a bioactive compound with potential pharmacological applications, particularly in cancer and inflammatory disease research. Structurally, it belongs to the acridine or quinoline derivative family, which are known for their roles as DNA intercalators or enzyme inhibitors. Lunacrine may exhibit antitumor, antimicrobial, or anti-inflammatory properties by interfering with nucleic acid processes or signaling pathways. While its precise mechanism of action requires further investigation, Lunacrine serves as a valuable tool in medicinal chemistry and drug discovery for targeted therapeutic development.
| CAS Number | 82-40-6 |
| Synonyms | (-)-Lunacrine; Lunacrine; Lunacrine, (-)- |
| Molecular Formula | C16H19NO3 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | FURO(2,3-b)quinolin-4(2H)-one, 3,9-dihydro-8-methoxy-9-methyl-2-(1-methylethyl)-, (2R)- |
| InChI | InChI=1S/C16H19NO3/c1-9(2)13-8-11-15(18)10-6-5-7-12(19-4)14(10)17(3)16(11)20-13/h5-7,9,13H,8H2,1-4H3/t13-/m1/s1 |
| InChIKey | FMEKJMQGMONLTQ-CYBMUJFWSA-N |
| SMILES | COc1cccc2C(=O)C3=C(O[C@H](C3)C(C)C)N(C)c12 |
| Reference | 1. Sekar M, Prasad KJR. Quinoline Alkaloids: Synthesis of Pyrano. J Nat Prod. 1998 Feb 27;61(2):294-6. doi: 10.1021/np970005i. PMID: 9548863. |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
