For research use only. Not for therapeutic Use.
Lusianthridin（Cat No.:I015009）is a naturally occurring compound isolated from certain plant species, known for its potential biological activities. It has demonstrated significant antimicrobial properties, showing effectiveness against a variety of bacteria and fungi. Additionally, lusianthridin has been explored for its antioxidant and anti-inflammatory effects, making it a candidate for use in treating conditions like infections and chronic inflammatory diseases. Research is still in the early stages to fully understand its mechanisms of action and therapeutic applications. Further studies are necessary to assess its safety, efficacy, and potential for use in pharmacological treatments.
| Catalog Number | I015009 |
| CAS Number | 87530-30-1 |
| Molecular Formula | C₁₅H₁₄O₃ |
| Purity | ≥95% |
| Target | c-Myc |
| IUPAC Name | 7-methoxy-9,10-dihydrophenanthrene-2,5-diol |
| InChI | InChI=1S/C15H14O3/c1-18-12-7-10-3-2-9-6-11(16)4-5-13(9)15(10)14(17)8-12/h4-8,16-17H,2-3H2,1H3 |
| InChIKey | RDKDIPDDUFMMMT-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C3=C(CC2)C=C(C=C3)O)C(=C1)O |
| Reference | [1]. Narumol Bhummaphan, et al. Targeting of Lung Cancer Stem Cells via Src-STAT3 Suppression. Phytomedicine. 2019 Sep;62:152932. |
