For research use only. Not for therapeutic Use.
Luteolin 3′-O-glucuronide is a glucuronidated derivative of luteolin, a flavonoid known for its antioxidant, anti-inflammatory, and anti-cancer properties. This specific compound features a glucuronic acid moiety attached to the 3′ position of the luteolin structure, enhancing its solubility and bioavailability. It occurs naturally in certain plants and plays a role in the metabolism of flavonoids within the human body. Research into this compound focuses on its potential therapeutic effects and pharmacokinetics.
| Catalog Number | R072600 |
| CAS Number | 53527-42-7 |
| Molecular Formula | C21H18O12 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| IUPAC Name | (2S,3S,4S,5R,6S)-6-[5-(5,7-dihydroxy-4-oxochromen-2-yl)-2-hydroxyphenoxy]-3,4,5-trihydroxyoxane-2-carboxylic acid |
| InChI | InChI=1S/C21H18O12/c22-8-4-10(24)15-11(25)6-12(31-14(15)5-8)7-1-2-9(23)13(3-7)32-21-18(28)16(26)17(27)19(33-21)20(29)30/h1-6,16-19,21-24,26-28H,(H,29,30)/t16-,17-,18+,19-,21+/m0/s1 |
| InChIKey | JDOFZOKGCYYUER-ZFORQUDYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)OC4C(C(C(C(O4)C(=O)O)O)O)O)O |
