Luteolin (CAT: I003729) is a flavonoid compound widely found in various plants, including fruits, vegetables, and medicinal herbs. It exhibits multiple pharmacological activities, including anti-inflammatory, antioxidant, anticancer, and neuroprotective properties. Luteolin exerts its effects through various mechanisms, such as inhibition of inflammatory mediators, modulation of cellular signaling pathways, and induction of apoptosis in cancer cells. It has been studied for its potential therapeutic applications in various diseases, including cancer, cardiovascular diseases, neurodegenerative disorders, and inflammatory conditions.
| Catalog Number | I003729 |
| CAS Number | 491-70-3 |
| Synonyms | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| Molecular Formula | C15H10O6 |
| Purity | ≥95% |
| Target | IκB/IKK |
| Solubility | DMSO: 35 mg/mL |
| Storage | Store at -20°C |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxychromen-4-one |
| InChI | InChI=1S/C15H10O6/c16-8-4-11(19)15-12(20)6-13(21-14(15)5-8)7-1-2-9(17)10(18)3-7/h1-6,16-19H |
| InChIKey | IQPNAANSBPBGFQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O)O)O)O |
| Reference | 1: Luo Y, Shang P, Li D. Luteolin: A Flavonoid that Has Multiple Cardio-Protective Effects and Its Molecular Mechanisms. Front Pharmacol. 2017 Oct 6;8:692. doi: 10.3389/fphar.2017.00692. eCollection 2017. Review. PubMed PMID: 29056912; PubMed Central PMCID: PMC5635727.<br /> |
