For research use only. Not for therapeutic Use.
Luxeptinib (Cat.No:I031184) is a small molecule inhibitor targeting multiple receptor tyrosine kinases, particularly vascular endothelial growth factor receptor 2 (VEGFR2) and fibroblast growth factor receptor 1 (FGFR1). It is being investigated for its potential in the treatment of various solid tumors, including gastric cancer and lung cancer. Luxeptinib acts by inhibiting angiogenesis and tumor growth, making it a promising therapeutic option in oncology.
| Catalog Number | I031184 |
| CAS Number | 1616428-23-9 |
| Synonyms | Luxeptinib; Luxeptinibum; |
| Molecular Formula | C25H17F4N5O2 |
| Purity | 98% |
| Target | Apoptosis |
| Solubility | To be determined |
| Appearance | Solid powder |
| Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
| IUPAC Name | 1-(3-fluoro-4-(7-(4-methyl-1H-imidazol-2-yl)-1-oxoisoindolin-4-yl)phenyl)-3-(2,4,6-trifluorophenyl)urea |
| InChI | InChI=1S/C25H17F4N5O2/c1-11-9-30-23(32-11)16-5-4-14(17-10-31-24(35)21(16)17)15-3-2-13(8-18(15)27)33-25(36)34-22-19(28)6-12(26)7-20(22)29/h2-9H,10H2,1H3,(H,30,32)(H,31,35)(H2,33,34,36) |
| InChIKey | MWHHJYUHCZWSLS-UHFFFAOYSA-N |
| SMILES | O=C(NC1=C(F)C=C(F)C=C1F)NC2=CC=C(C3=CC=C(C4=NC(C)=CN4)C5=C3CNC5=O)C(F)=C2 |
