For research use only. Not for therapeutic Use.
LV-320 (Cat No.: I019470) is a potent, small-molecule inhibitor of the enzyme Bruton’s tyrosine kinase (BTK). BTK plays a critical role in B-cell receptor signaling and is involved in the development and activation of B cells, which are essential for immune responses. LV-320 has shown promise as a targeted therapy for hematologic malignancies, such as chronic lymphocytic leukemia (CLL) and other B-cell-related cancers. By inhibiting BTK, LV-320 aims to disrupt the survival and proliferation of malignant B cells, potentially improving treatment outcomes.
CAS Number | 2449093-46-1 |
Molecular Formula | C₂₉H₂₆ClNO₂S₂ |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | 3-[[4-[(E)-2-(7-chloroquinolin-4-yl)ethenyl]phenyl]-(2-phenylethylsulfanyl)methyl]sulfanylpropanoic acid |
InChI | 1S/C29H26ClNO2S2/c30-25-12-13-26-23(14-17-31-27(26)20-25)9-6-22-7-10-24(11-8-22)29(35-19-16-28(32)33)34-18-15-21-4-2-1-3-5-21/h1-14,17,20,29H,15-16,18-19H2,(H,32,33)/b9-6+ |
InChIKey | PHENTWJNXGESKT-RMKNXTFCSA-N |
SMILES | C1=CC=C(C=C1)CCSC(C2=CC=C(C=C2)/C=C/C3=C4C=CC(=CC4=NC=C3)Cl)SCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |