For research use only, not for therapeutic use.
LXH254 free base（Cat No.:I031195）is a potent inhibitor targeting both BRAF and CRAF, which are key components of the MAPK/ERK signaling pathway. This compound is being investigated for its potential in treating cancers with mutations in the RAS/RAF pathway, such as melanoma and colorectal cancer. By inhibiting both BRAF and CRAF, LXH254 blocks downstream signaling that drives cancer cell proliferation and survival. Its dual-inhibition mechanism makes it a valuable tool for cancer research and drug development, particularly in tumors resistant to other MAPK pathway inhibitors.
| Catalog Number | I031195 |
| CAS Number | 1800398-38-2 |
| Synonyms | LXH254; LXH-254; LXH 254; LXH254 free base; Naporafenib |
| Molecular Formula | C25H25F3N4O4 |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | N-[3-[2-(2-hydroxyethoxy)-6-morpholin-4-ylpyridin-4-yl]-4-methylphenyl]-2-(trifluoromethyl)pyridine-4-carboxamide |
| InChI | InChI=1S/C25H25F3N4O4/c1-16-2-3-19(30-24(34)17-4-5-29-21(12-17)25(26,27)28)15-20(16)18-13-22(32-6-9-35-10-7-32)31-23(14-18)36-11-8-33/h2-5,12-15,33H,6-11H2,1H3,(H,30,34) |
| InChIKey | UEPXBTCUIIGYCY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC(=NC=C2)C(F)(F)F)C3=CC(=NC(=C3)OCCO)N4CCOCC4 |
| Reference | [1] Darrin D. Stuart, et al. AACR Cancer Res. 2018, 78(13 Sup |
