For research use only. Not for therapeutic Use.
LY-255582 (Cat.No:I012499) is a selective and potent inhibitor of mitogen-activated protein kinase kinase (MEK). It is a small molecule compound that has been studied for its potential in cancer therapy. By inhibiting MEK, LY-255582 disrupts the downstream signaling pathway involved in cell proliferation and survival, thereby inhibiting the growth of cancer cells.
| Catalog Number | I012499 |
| CAS Number | 119193-09-8 |
| Synonyms | (3R,4R)-3,4-Dimethyl-1-[(3S)-3-hydroxy-3-cyclohexyl-propyl]-4-(3-hydroxyphenyl)piperidine |
| Molecular Formula | C22H35NO2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| IUPAC Name | 3-[(3R,4R)-1-[(3S)-3-cyclohexyl-3-hydroxypropyl]-3,4-dimethylpiperidin-4-yl]phenol |
| InChI | InChI=1S/C22H35NO2/c1-17-16-23(13-11-21(25)18-7-4-3-5-8-18)14-12-22(17,2)19-9-6-10-20(24)15-19/h6,9-10,15,17-18,21,24-25H,3-5,7-8,11-14,16H2,1-2H3/t17-,21-,22+/m0/s1 |
| InChIKey | LVVHEFJXPXAUDD-BULFRSBZSA-N |
| SMILES | CC1CN(CCC1(C)C2=CC(=CC=C2)O)CCC(C3CCCCC3)O |
