For research use only. Not for therapeutic Use.
LY 272015 hydrochloride (Cat.No:I010695) is a selective serotonin reuptake inhibitor (SSRI). It acts by blocking the reuptake of serotonin, a neurotransmitter involved in regulating mood, thereby increasing serotonin levels in the brain. LY 272015 hydrochloride has been studied for its potential in the treatment of depression and other mood disorders.
| Catalog Number | I010695 |
| CAS Number | 172895-15-7 |
| Synonyms | 1-[(3,4-Dimethoxyphenyl)methy]-2,3,4,9-tetrahydro-6-methyl-1H-pyrido[3,4-b]indole hydrochloride |
| Molecular Formula | C21H25ClN2O2 |
| Purity | ≥95% |
| Target | Neuronal Signaling |
| Solubility | Soluble to 100 mM in DMSO and to 10 mM in ethanol |
| Storage | Store at +4C |
| IUPAC Name | 1-[(3,4-dimethoxyphenyl)methyl]-6-methyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| InChI | InChI=1S/C21H24N2O2.ClH/c1-13-4-6-17-16(10-13)15-8-9-22-18(21(15)23-17)11-14-5-7-19(24-2)20(12-14)25-3;/h4-7,10,12,18,22-23H,8-9,11H2,1-3H3;1H |
| InChIKey | BKAZOTIBKRWLQA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)NC3=C2CCNC3CC4=CC(=C(C=C4)OC)OC.Cl |
