For research use only. Not for therapeutic Use.
LY-2835219（Cat No.:I000912）, also known as Abemaciclib, is a potent and selective inhibitor of cyclin-dependent kinases 4 and 6 (CDK4/6). It works by blocking the phosphorylation of the retinoblastoma (Rb) protein, preventing the transition from the G1 phase to the S phase of the cell cycle, leading to cell cycle arrest and apoptosis. Abemaciclib is primarily used in cancer therapy, particularly for hormone receptor-positive (HR+) and HER2-negative breast cancer. Its oral bioavailability and ability to cross the blood-brain barrier make it an effective option in targeted cancer treatments.
| Catalog Number | I000912 |
| CAS Number | 1231930-82-7 |
| Synonyms | N-[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]-5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-amine;methanesulfonic acid |
| Molecular Formula | C₂₇H₃₂F₂N₈.CH₄O₃S |
| Purity | ≥95% |
| Target | Cyclin-Dependent Kinases |
| Solubility | DMSO:84 mg/mL; Water:100 mg/mL |
| Storage | 3 years -20℃ powder |
| IC50 | 2 nM(CDK4); 10 nM(CDK6) |
| IUPAC Name | N-[5-[(4-ethylpiperazin-1-yl)methyl]pyridin-2-yl]-5-fluoro-4-(7-fluoro-2-methyl-3-propan-2-ylbenzimidazol-5-yl)pyrimidin-2-amine;methanesulfonic acid |
| InChI | InChI=1S/C27H32F2N8.CH4O3S/c1-5-35-8-10-36(11-9-35)16-19-6-7-24(30-14-19)33-27-31-15-22(29)25(34-27)20-12-21(28)26-23(13-20)37(17(2)3)18(4)32-26;1-5(2,3)4/h6-7,12-15,17H,5,8-11,16H2,1-4H3,(H,30,31,33,34);1H3,(H,2,3,4) |
| InChIKey | NCJPFQPEVDHJAZ-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=CN=C(C=C2)NC3=NC=C(C(=N3)C4=CC5=C(C(=C4)F)N=C(N5C(C)C)C)F.CS(=O)(=O)O |
| Reference | <p style=/line-height:25px/> |
