For research use only. Not for therapeutic Use.
LY 344864 S-enantiomer is the S-enantiomer of LY344864. LY344864 is a 5-HT1F receptor agonist.
| Catalog Number | I002407 |
| CAS Number | 186544-27-4 |
| Synonyms | N-[(6S)-6-(dimethylamino)-6,7,8,9-tetrahydro-5H-carbazol-3-yl]-4-fluorobenzamide |
| Molecular Formula | C21H22FN3O |
| Purity | ≥95% |
| InChI | InChI=1S/C21H22FN3O/c1-25(2)16-8-10-20-18(12-16)17-11-15(7-9-19(17)24-20)23-21(26)13-3-5-14(22)6-4-13/h3-7,9,11,16,24H,8,10,12H2,1-2H3,(H,23,26)/t16-/m0/s1 |
| InChIKey | GKWHICIUSVVNGX-INIZCTEOSA-N |
| SMILES | CN(C)C1CCC2=C(C1)C3=C(N2)C=CC(=C3)NC(=O)C4=CC=C(C=C4)F |
| Reference | [1]. Kirk Willis Johnson. Excitatory amino acid receptor antagonist and 5-ht1f agonist combination: a method for the treatment of neurological disorders. WO 2002053139A2. |
