For research use only. Not for therapeutic Use.
LY-83583 is a biochemical compound known as a guanylate cyclase inhibitor, primarily used in research to study the regulation of cyclic GMP (cGMP) levels in cells. By inhibiting guanylate cyclase, LY-83583 reduces the production of cGMP, which is important for various physiological processes, including vasodilation and smooth muscle relaxation. It has been employed in cardiovascular research and studies involving signal transduction pathways. LY-83583 is valuable for investigating diseases related to nitric oxide and cGMP signaling.
| Catalog Number | R000024 |
| CAS Number | 91300-60-6 |
| Synonyms | 6-Anilinoquinoline-5,8-quinone; 5,8-Dihydro-5,8-dioxo-6-(phenylamino)quinoline; 6-(phenylamino)-5,8-quinolinedione; LY 83583; |
| Molecular Formula | C15H10N2O2 |
| Purity | ≥95% |
| Target | Guanylate Cyclase |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 6-anilinoquinoline-5,8-dione |
| InChI | InChI=1S/C15H10N2O2/c18-13-9-12(17-10-5-2-1-3-6-10)15(19)11-7-4-8-16-14(11)13/h1-9,17H |
| InChIKey | GXIJYWUWLNHKNW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC(=O)C3=C(C2=O)C=CC=N3 |
