For research use only. Not for therapeutic Use.
LY1（Cat No.:I042359）is a small molecule inhibitor that targets specific proteins involved in cancer cell growth and survival, particularly in hematological malignancies. It is known for its selective inhibition of key signaling pathways that regulate tumor progression. LY1 has shown promise in preclinical studies by blocking the function of proteins that are critical for cancer cell proliferation and resistance to apoptosis. Its targeted action makes it a potential therapeutic agent for treating cancers, such as leukemia and lymphoma, by disrupting the molecular pathways that sustain tumor growth and survival.
| CAS Number | 2883813-32-7 |
| Synonyms | 2,2-dioxo-5-(2-piperazin-1-ylanilino)-2λ6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),3,5,8(12),9-pentaen-7-one;hydrochloride |
| Molecular Formula | C20H19ClN4O3S |
| Purity | ≥95% |
| IUPAC Name | 2,2-dioxo-5-(2-piperazin-1-ylanilino)-2lambda6-thia-3-azatricyclo[6.3.1.04,12]dodeca-1(11),3,5,8(12),9-pentaen-7-one;hydrochloride |
| InChI | InChI=1S/C20H18N4O3S.ClH/c25-17-12-15(20-19-13(17)4-3-7-18(19)28(26,27)23-20)22-14-5-1-2-6-16(14)24-10-8-21-9-11-24;/h1-7,12,21-22H,8-11H2;1H |
| InChIKey | RVXKOLGQSWIVHC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=CC=CC=C2NC3=CC(=O)C4=C5C3=NS(=O)(=O)C5=CC=C4.Cl |
