For research use only. Not for therapeutic Use.
LY2228820（Cat No.:I005171）, also known as Ralimetinib, is a selective inhibitor of p38 MAPK (mitogen-activated protein kinase). It plays a crucial role in modulating cellular responses to stress and inflammation, making it a valuable compound in cancer and inflammatory disease research. By blocking p38 MAPK activity, LY2228820 inhibits the production of pro-inflammatory cytokines and limits cancer cell proliferation. This compound has been investigated in clinical trials for its potential to enhance the efficacy of chemotherapy and other targeted therapies, particularly in solid tumors like ovarian and breast cancer.
| Catalog Number | I005171 |
| CAS Number | 862507-23-1 |
| Synonyms | 5-[2-tert-butyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]-3-(2,2-dimethylpropyl)imidazo[4,5-b]pyridin-2-amine;methanesulfonic acid |
| Molecular Formula | C₂₆H₃₇FN₆O₆S₂ |
| Purity | ≥95% |
| Target | Autophagy |
| Solubility | DMSO:38mg/mL |
| Storage | 3 years -20C powder |
| IC50 | 7/3 nM(p38α/p38β MAPK) |
| IUPAC Name | 5-[2-tert-butyl-4-(4-fluorophenyl)-1H-imidazol-5-yl]-3-(2,2-dimethylpropyl)imidazo[4,5-b]pyridin-2-amine;methanesulfonic acid |
| InChI | InChI=1S/C24H29FN6.2CH4O3S/c1-23(2,3)13-31-20-17(28-22(31)26)12-11-16(27-20)19-18(14-7-9-15(25)10-8-14)29-21(30-19)24(4,5)6;2*1-5(2,3)4/h7-12H,13H2,1-6H3,(H2,26,28)(H,29,30);2*1H3,(H,2,3,4) |
| InChIKey | NARMJPIBAXVUIE-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CN1C2=C(C=CC(=N2)C3=C(N=C(N3)C(C)(C)C)C4=CC=C(C=C4)F)N=C1N.CS(=O)(=O)O.CS(=O)(=O)O |
| Reference | <p style=/line-height:25px/> |
