For research use only. Not for therapeutic Use.
LY231617（Cat No.:R036121）is a potent and selective inhibitor of the enzyme glycogen synthase kinase-3 (GSK-3), a critical regulator in various cellular processes such as metabolism, cell survival, and inflammation. By inhibiting GSK-3, LY231617 modulates key signaling pathways, particularly those involved in neurodegenerative diseases, diabetes, and cancer. It has been studied for its potential therapeutic applications in conditions like Alzheimer’s disease, bipolar disorder, and various cancers. LY231617’s ability to influence GSK-3 activity provides valuable insight into the development of novel treatments targeting this enzyme for a wide range of diseases.
| CAS Number | 141545-89-3 |
| Synonyms | 2,6-ditert-butyl-4-(ethylaminomethyl)phenol;hydrochloride |
| Molecular Formula | C17H30ClNO |
| Purity | ≥95% |
| IUPAC Name | 2,6-ditert-butyl-4-(ethylaminomethyl)phenol;hydrochloride |
| InChI | InChI=1S/C17H29NO.ClH/c1-8-18-11-12-9-13(16(2,3)4)15(19)14(10-12)17(5,6)7;/h9-10,18-19H,8,11H2,1-7H3;1H |
| InChIKey | SIWZKGFBUXQFDK-UHFFFAOYSA-N |
| SMILES | CCNCC1=CC(=C(C(=C1)C(C)(C)C)O)C(C)(C)C.Cl |
