For research use only. Not for therapeutic Use.
LY2389575 hydrochloride（Cat No.:I011065）is a selective and potent inhibitor of the enzyme FAAH (fatty acid amide hydrolase), which is responsible for breaking down endocannabinoids like anandamide. By inhibiting FAAH, LY2389575 increases the levels of these endogenous cannabinoids, potentially enhancing their effects on pain, mood, and inflammation. This compound is being investigated for its therapeutic potential in treating conditions such as chronic pain, anxiety, and mood disorders. Ongoing research aims to assess its pharmacological profile, safety, and efficacy in clinical settings, particularly in relation to its impact on the endocannabinoid system.
| CAS Number | 885104-09-6 |
| Synonyms | (3S)-1-(5-bromopyrimidin-2-yl)-N-[(2,4-dichlorophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| Molecular Formula | C15H16BrCl3N4 |
| Purity | ≥95% |
| IUPAC Name | (3S)-1-(5-bromopyrimidin-2-yl)-N-[(2,4-dichlorophenyl)methyl]pyrrolidin-3-amine;hydrochloride |
| InChI | InChI=1S/C15H15BrCl2N4.ClH/c16-11-7-20-15(21-8-11)22-4-3-13(9-22)19-6-10-1-2-12(17)5-14(10)18;/h1-2,5,7-8,13,19H,3-4,6,9H2;1H/t13-;/m0./s1 |
| InChIKey | IRIBLLOEUZMCQY-ZOWNYOTGSA-N |
| SMILES | C1CN(C[C@H]1NCC2=C(C=C(C=C2)Cl)Cl)C3=NC=C(C=N3)Br.Cl |
