For research use only, not for therapeutic use.
LY2606368（Cat No.:I000926）is a potent and selective inhibitor of checkpoint kinase 1 (CHK1), a critical regulator of the DNA damage response. By inhibiting CHK1, LY2606368 disrupts cell cycle arrest, leading to increased DNA damage and apoptosis, particularly in cancer cells with defective DNA repair mechanisms. This compound enhances the cytotoxic effects of DNA-damaging agents, making it a promising candidate for combination cancer therapies. LY2606368 is widely studied in oncology research for its ability to sensitize tumors to radiation and chemotherapy, offering potential for improved cancer treatment strategies.
| Catalog Number | I000926 |
| CAS Number | 1234015-52-1 |
| Synonyms | (Z)-5-((5-(2-(3-aminopropoxy)-6-methoxyphenyl)-1H-pyrazol-3(2H)-ylidene)amino)pyrazine-2-carbonitrile |
| Molecular Formula | C18H19N7O2 |
| Purity | ≥95% |
| Target | Chk |
| Solubility | DMSO: ≥ 60 mg/mL |
| Storage | Store at -20C |
| Overview of Clinical Research | LY2606368 is considered as Checkpoint kinase 1 inhibitor. The preclinical trails in head and neck cancer in USA finished in 2020. |
| IC50 | 1.5 nM (SW1990 cell line) |
| IUPAC Name | 5-[[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]amino]pyrazine-2-carbonitrile |
| InChI | InChI=1S/C18H19N7O2/c1-26-14-4-2-5-15(27-7-3-6-19)18(14)13-8-16(25-24-13)23-17-11-21-12(9-20)10-22-17/h2,4-5,8,10-11H,3,6-7,19H2,1H3,(H2,22,23,24,25) |
| InChIKey | DOTGPNHGTYJDEP-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC=C1)OCCCN)C2=CC(=NN2)NC3=NC=C(N=C3)C#N |
| Reference | <p style=”/line-height:25px/”> |
