For research use only. Not for therapeutic Use.
LY2812223(Cat No.:I018766)is a small molecule compound that serves as a selective inhibitor of the enzyme phosphoinositide 3-kinase (PI3K). PI3K is a key enzyme involved in cellular processes such as growth, metabolism, and survival, and its dysregulation is often associated with cancer and other diseases. LY2812223 has been investigated for its potential therapeutic applications in treating cancers, particularly those with mutations in the PI3K pathway. By inhibiting PI3K, LY2812223 may help to reduce tumor growth and enhance the efficacy of other cancer treatments. It is still under investigation in clinical research.
CAS Number | 1311385-20-2 |
Molecular Formula | C₁₀H₁₂N₄O₄S |
Purity | ≥95% |
Target | Neuronal Signaling |
IUPAC Name | (1R,2S,4R,5R,6R)-2-amino-4-(1H-1,2,4-triazol-5-ylsulfanyl)bicyclo[3.1.0]hexane-2,6-dicarboxylic acid |
InChI | InChI=1S/C10H12N4O4S/c11-10(8(17)18)1-3(19-9-12-2-13-14-9)4-5(6(4)10)7(15)16/h2-6H,1,11H2,(H,15,16)(H,17,18)(H,12,13,14)/t3-,4+,5+,6+,10+/m1/s1 |
InChIKey | YSOWRGMLMZQSBX-AVUIYAGVSA-N |
SMILES | C1[C@H]([C@H]2[C@@H]([C@H]2[C@@]1(C(=O)O)N)C(=O)O)SC3=NC=NN3 |