For research use only. Not for therapeutic Use.
LY364947 (CAT: I003448) is a potent ATP-competitive inhibitor of transforming growth factor beta receptor type I (TGFβR-I). It specifically targets and inhibits the activity of TGFβR-I, which is a key receptor involved in the TGF-β signaling pathway. By blocking the activity of TGFβR-I, LY364947 disrupts the signaling cascade mediated by TGF-β, a cytokine that plays a crucial role in regulating various cellular processes including cell growth, differentiation, and immune response. LY364947 demonstrates an inhibitory concentration (IC50) of 59 nM against TGFβR-I and exhibits 7-fold selectivity over TGFβR-II, another receptor involved in TGF-β signaling. This selectivity allows for specific targeting of TGFβR-I activity, potentially modulating TGF-β signaling pathways in various biological contexts.
| Catalog Number | I003448 |
| CAS Number | 396129-53-6 |
| Synonyms | 4-(5-pyridin-2-yl-1H-pyrazol-4-yl)quinoline |
| Molecular Formula | C17H12N4 |
| Purity | ≥95% |
| Target | SMAD |
| Solubility | DMSO: ≥ 25 mg/mL |
| Storage | -20 ℃ |
| IC50 | 59 nM |
| IUPAC Name | 4-(5-pyridin-2-yl-1H-pyrazol-4-yl)quinoline |
| InChI | InChI=1S/C17H12N4/c1-2-6-15-13(5-1)12(8-10-19-15)14-11-20-21-17(14)16-7-3-4-9-18-16/h1-11H,(H,20,21) |
| InChIKey | IBCXZJCWDGCXQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=N2)C3=C(NN=C3)C4=CC=CC=N4 |
